ChemNet > CAS > 69625-13-4 2-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]acetonitrile
69625-13-4 2-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]acetonitrile
상품명칭 |
2-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]acetonitrile |
별명 |
[4-(4-nitrophenyl)-1,3-thiazol-2-yl]acetonitrile |
분자식 |
C11H7N3O2S |
분자량 |
245.2572 |
InChI |
InChI=1/C11H7N3O2S/c12-6-5-11-13-10(7-17-11)8-1-3-9(4-2-8)14(15)16/h1-4,7H,5H2 |
cas번호 |
69625-13-4 |
분자 구조 |
|
밀도 |
1.397g/cm3 |
녹는 점 |
147℃ |
비등점 |
457.3°C at 760 mmHg |
굴절 지수 |
1.641 |
인화점 |
230.3°C |
위험성 표시 |
Xn:Harmful;
|
리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
보안 규칙 |
S36/37:Wear suitable protective clothing and gloves.;
|
|